C17H17N3O3 — CID 110354585
N-benzyl-7-nitro-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 110354585) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-benzyl-7-nitro-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | N-benzyl-7-nitro-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 110354585 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-benzyl-7-nitro-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H17N3O3/c21-17(18-12-13-5-2-1-3-6-13)19-10-4-7-14-8-9-15(20(22)23)11-16(14)19/h1-3,5-6,8-9,11H,4,7,10,12H2,(H,18,21) |
| InChIKey | QOIKAGRSMLQXCB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|