C18H18N4O4 — CID 18125568
N-(benzylcarbamoyl)-2-(5-nitro-2,3-dihydroindol-1-yl)acetamide (PubChem CID 18125568) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2-(5-nitro-2,3-dihydroindol-1-yl)acetamide.
| Compound Name | N-(benzylcarbamoyl)-2-(5-nitro-2,3-dihydroindol-1-yl)acetamide |
|---|---|
| PubChem CID | 18125568 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-(benzylcarbamoyl)-2-(5-nitro-2,3-dihydroindol-1-yl)acetamide |
| SMILES | O=C(CN1CCc2cc([N+](=O)[O-])ccc21)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H18N4O4/c23-17(20-18(24)19-11-13-4-2-1-3-5-13)12-21-9-8-14-10-15(22(25)26)6-7-16(14)21/h1-7,10H,8-9,11-12H2,(H2,19,20,23,24) |
| InChIKey | RPDFBJHIJMFVTN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|