C20H23N5O6S — CID 3930007
N-(benzylcarbamoyl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 3930007) has the molecular formula C20H23N5O6S and a molecular weight of 461.50 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(benzylcarbamoyl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 3930007 |
| Molecular Formula | C20H23N5O6S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-(benzylcarbamoyl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H23N5O6S/c26-19(22-20(27)21-14-16-6-2-1-3-7-16)15-23-10-12-24(13-11-23)32(30,31)18-9-5-4-8-17(18)25(28)29/h1-9H,10-15H2,(H2,21,22,26,27) |
| InChIKey | YEFFOWNUYYVITK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|