C17H17N5O5S2 — CID 2500298
N-(3-cyanothiophen-2-yl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 2500298) has the molecular formula C17H17N5O5S2 and a molecular weight of 435.49 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 2500298 |
| Molecular Formula | C17H17N5O5S2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | N#Cc1ccsc1NC(=O)CN1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H17N5O5S2/c18-11-13-5-10-28-17(13)19-16(23)12-20-6-8-21(9-7-20)29(26,27)15-4-2-1-3-14(15)22(24)25/h1-5,10H,6-9,12H2,(H,19,23) |
| InChIKey | SPLDNSQTLRDWBX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|