C19H21ClN4O5S — CID 2655862
N-(5-chloro-2-methylphenyl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 2655862) has the molecular formula C19H21ClN4O5S and a molecular weight of 452.92 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 2655862 |
| Molecular Formula | C19H21ClN4O5S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CN1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H21ClN4O5S/c1-14-6-7-15(20)12-16(14)21-19(25)13-22-8-10-23(11-9-22)30(28,29)18-5-3-2-4-17(18)24(26)27/h2-7,12H,8-11,13H2,1H3,(H,21,25) |
| InChIKey | GGNFDMMQNQBAMD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|