C22H24F3N5O4 — CID 46551379
N-(benzylcarbamoyl)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide (PubChem CID 46551379) has the molecular formula C22H24F3N5O4 and a molecular weight of 479.46 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide.
| Compound Name | N-(benzylcarbamoyl)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 46551379 |
| Molecular Formula | C22H24F3N5O4 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | N-(benzylcarbamoyl)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide |
| SMILES | O=C(CCN1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H24F3N5O4/c23-22(24,25)17-6-7-18(19(14-17)30(33)34)29-12-10-28(11-13-29)9-8-20(31)27-21(32)26-15-16-4-2-1-3-5-16/h1-7,14H,8-13,15H2,(H2,26,27,31,32) |
| InChIKey | MGHFNJOTTBSBQO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|