C24H21F4N3O3 — CID 71591339
1-(4-fluoronaphthalen-1-yl)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one (PubChem CID 71591339) has the molecular formula C24H21F4N3O3 and a molecular weight of 475.44 g/mol. Its IUPAC name is 1-(4-fluoronaphthalen-1-yl)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-(4-fluoronaphthalen-1-yl)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 71591339 |
| Molecular Formula | C24H21F4N3O3 |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 1-(4-fluoronaphthalen-1-yl)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCN1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1)c1ccc(F)c2ccccc12 |
| InChI | InChI=1S/C24H21F4N3O3/c25-20-7-6-19(17-3-1-2-4-18(17)20)23(32)9-10-29-11-13-30(14-12-29)21-8-5-16(24(26,27)28)15-22(21)31(33)34/h1-8,15H,9-14H2 |
| InChIKey | VZDMYNLXIQFBCW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|