C22H21F3N4O3 — CID 31376721
1-(2-methyl-1H-indol-3-yl)-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone (PubChem CID 31376721) has the molecular formula C22H21F3N4O3 and a molecular weight of 446.43 g/mol. Its IUPAC name is 1-(2-methyl-1H-indol-3-yl)-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(2-methyl-1H-indol-3-yl)-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 31376721 |
| Molecular Formula | C22H21F3N4O3 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 1-(2-methyl-1H-indol-3-yl)-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)CN1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H21F3N4O3/c1-14-21(16-4-2-3-5-17(16)26-14)20(30)13-27-8-10-28(11-9-27)18-7-6-15(22(23,24)25)12-19(18)29(31)32/h2-7,12,26H,8-11,13H2,1H3 |
| InChIKey | VHZMCDBSIMLXID-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|