C19H24F3N5O3 — CID 55356771
N-(2-cyano-3-methylbutan-2-yl)-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide (PubChem CID 55356771) has the molecular formula C19H24F3N5O3 and a molecular weight of 427.43 g/mol. Its IUPAC name is N-(2-cyano-3-methylbutan-2-yl)-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-cyano-3-methylbutan-2-yl)-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55356771 |
| Molecular Formula | C19H24F3N5O3 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | N-(2-cyano-3-methylbutan-2-yl)-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
| SMILES | CC(C)C(C)(C#N)NC(=O)CN1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H24F3N5O3/c1-13(2)18(3,12-23)24-17(28)11-25-6-8-26(9-7-25)15-5-4-14(19(20,21)22)10-16(15)27(29)30/h4-5,10,13H,6-9,11H2,1-3H3,(H,24,28) |
| InChIKey | VQJFNQGYYKAPSE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|