C25H31F3N4O3 — CID 31376727
N-[2,6-di(propan-2-yl)phenyl]-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide (PubChem CID 31376727) has the molecular formula C25H31F3N4O3 and a molecular weight of 492.54 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 31376727 |
| Molecular Formula | C25H31F3N4O3 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CN1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C25H31F3N4O3/c1-16(2)19-6-5-7-20(17(3)4)24(19)29-23(33)15-30-10-12-31(13-11-30)21-9-8-18(25(26,27)28)14-22(21)32(34)35/h5-9,14,16-17H,10-13,15H2,1-4H3,(H,29,33) |
| InChIKey | QTGYGTRJTGXYOQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|