C19H19ClF4N4O3 — CID 18778022
2-[4-(2-fluorophenyl)piperazin-1-yl]-N-[2-nitro-4-(trifluoromethyl)phenyl]acetamide;hydrochloride (PubChem CID 18778022) has the molecular formula C19H19ClF4N4O3 and a molecular weight of 462.83 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-[2-nitro-4-(trifluoromethyl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-[2-nitro-4-(trifluoromethyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 18778022 |
| Molecular Formula | C19H19ClF4N4O3 |
| Molecular Weight | 462.83 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-[2-nitro-4-(trifluoromethyl)phenyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1CCN(c2ccccc2F)CC1)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18F4N4O3.ClH/c20-14-3-1-2-4-16(14)26-9-7-25(8-10-26)12-18(28)24-15-6-5-13(19(21,22)23)11-17(15)27(29)30;/h1-6,11H,7-10,12H2,(H,24,28);1H |
| InChIKey | OZPZAHFAAXFGCG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.83 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|