C20H19ClF3N3O3 — CID 4239098
1-(4-chlorophenyl)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one (PubChem CID 4239098) has the molecular formula C20H19ClF3N3O3 and a molecular weight of 441.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-(4-chlorophenyl)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 4239098 |
| Molecular Formula | C20H19ClF3N3O3 |
| Molecular Weight | 441.84 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCN1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClF3N3O3/c21-16-4-1-14(2-5-16)19(28)7-8-25-9-11-26(12-10-25)17-6-3-15(20(22,23)24)13-18(17)27(29)30/h1-6,13H,7-12H2 |
| InChIKey | FCMYKKGAUBAQAB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|