C23H24F3N3O5 — CID 55913552
1-(4-methoxyphenyl)-5-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]pentane-1,5-dione (PubChem CID 55913552) has the molecular formula C23H24F3N3O5 and a molecular weight of 479.46 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]pentane-1,5-dione.
| Compound Name | 1-(4-methoxyphenyl)-5-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]pentane-1,5-dione |
|---|---|
| PubChem CID | 55913552 |
| Molecular Formula | C23H24F3N3O5 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 1-(4-methoxyphenyl)-5-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]pentane-1,5-dione |
| SMILES | COc1ccc(C(=O)CCCC(=O)N2CCN(c3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C23H24F3N3O5/c1-34-18-8-5-16(6-9-18)21(30)3-2-4-22(31)28-13-11-27(12-14-28)19-10-7-17(23(24,25)26)15-20(19)29(32)33/h5-10,15H,2-4,11-14H2,1H3 |
| InChIKey | NWUJNOGHQDZKNC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|