C19H17BrF3N3O4 — CID 30699063
(2-bromo-5-methoxyphenyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 30699063) has the molecular formula C19H17BrF3N3O4 and a molecular weight of 488.26 g/mol. Its IUPAC name is (2-bromo-5-methoxyphenyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | (2-bromo-5-methoxyphenyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 30699063 |
| Molecular Formula | C19H17BrF3N3O4 |
| Molecular Weight | 488.26 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | (2-bromo-5-methoxyphenyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | COc1ccc(Br)c(C(=O)N2CCN(c3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)c1 |
| InChI | InChI=1S/C19H17BrF3N3O4/c1-30-13-3-4-15(20)14(11-13)18(27)25-8-6-24(7-9-25)16-5-2-12(19(21,22)23)10-17(16)26(28)29/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | TUBIQFWUWHNVFL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|