C23H19BrF3N3O4 — CID 21168863
(4-bromo-3-methoxynaphthalen-2-yl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 21168863) has the molecular formula C23H19BrF3N3O4 and a molecular weight of 538.32 g/mol. Its IUPAC name is (4-bromo-3-methoxynaphthalen-2-yl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | (4-bromo-3-methoxynaphthalen-2-yl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 21168863 |
| Molecular Formula | C23H19BrF3N3O4 |
| Molecular Weight | 538.32 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | (4-bromo-3-methoxynaphthalen-2-yl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | COc1c(C(=O)N2CCN(c3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)cc2ccccc2c1Br |
| InChI | InChI=1S/C23H19BrF3N3O4/c1-34-21-17(12-14-4-2-3-5-16(14)20(21)24)22(31)29-10-8-28(9-11-29)18-7-6-15(23(25,26)27)13-19(18)30(32)33/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | FNINZLUWRFQLEC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.32 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|