C20H20F3N5O5 — CID 29228566
[2-(dimethylamino)-5-nitrophenyl]-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 29228566) has the molecular formula C20H20F3N5O5 and a molecular weight of 467.40 g/mol. Its IUPAC name is [2-(dimethylamino)-5-nitrophenyl]-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | [2-(dimethylamino)-5-nitrophenyl]-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 29228566 |
| Molecular Formula | C20H20F3N5O5 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | [2-(dimethylamino)-5-nitrophenyl]-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | CN(C)c1ccc([N+](=O)[O-])cc1C(=O)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H20F3N5O5/c1-24(2)16-6-4-14(27(30)31)12-15(16)19(29)26-9-7-25(8-10-26)17-5-3-13(20(21,22)23)11-18(17)28(32)33/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | SYMZKEHMJOXMKV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|