C18H23F3N4O4 — CID 56538301
4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-4-oxo-N-propylbutanamide (PubChem CID 56538301) has the molecular formula C18H23F3N4O4 and a molecular weight of 416.40 g/mol. Its IUPAC name is 4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-4-oxo-N-propylbutanamide.
| Compound Name | 4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-4-oxo-N-propylbutanamide |
|---|---|
| PubChem CID | 56538301 |
| Molecular Formula | C18H23F3N4O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-4-oxo-N-propylbutanamide |
| SMILES | CCCNC(=O)CCC(=O)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H23F3N4O4/c1-2-7-22-16(26)5-6-17(27)24-10-8-23(9-11-24)14-4-3-13(18(19,20)21)12-15(14)25(28)29/h3-4,12H,2,5-11H2,1H3,(H,22,26) |
| InChIKey | QXIOGTCPOKBKDR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|