C13H10N2O4 — CID 110287360
furan-2-yl-(6-nitro-2,3-dihydroindol-1-yl)methanone (PubChem CID 110287360) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is furan-2-yl-(6-nitro-2,3-dihydroindol-1-yl)methanone.
| Compound Name | furan-2-yl-(6-nitro-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 110287360 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | furan-2-yl-(6-nitro-2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C13H10N2O4/c16-13(12-2-1-7-19-12)14-6-5-9-3-4-10(15(17)18)8-11(9)14/h1-4,7-8H,5-6H2 |
| InChIKey | PMNCYRWODPZYGX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|