C14H17N3O3 — CID 32728455
1-(6-nitro-2,3-dihydroindol-1-yl)-2-pyrrolidin-1-ylethanone (PubChem CID 32728455) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(6-nitro-2,3-dihydroindol-1-yl)-2-pyrrolidin-1-ylethanone.
| Compound Name | 1-(6-nitro-2,3-dihydroindol-1-yl)-2-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 32728455 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(6-nitro-2,3-dihydroindol-1-yl)-2-pyrrolidin-1-ylethanone |
| SMILES | O=C(CN1CCCC1)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C14H17N3O3/c18-14(10-15-6-1-2-7-15)16-8-5-11-3-4-12(17(19)20)9-13(11)16/h3-4,9H,1-2,5-8,10H2 |
| InChIKey | NPSDISVXBNNEDR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|