C20H20N6O3 — CID 86919321
2-[4-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 86919321) has the molecular formula C20H20N6O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is 2-[4-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[4-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 86919321 |
| Molecular Formula | C20H20N6O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-[4-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N1CCN(CC(=O)N2CCc3ccc([N+](=O)[O-])cc32)CC1 |
| InChI | InChI=1S/C20H20N6O3/c21-13-16-2-1-6-22-20(16)24-10-8-23(9-11-24)14-19(27)25-7-5-15-3-4-17(26(28)29)12-18(15)25/h1-4,6,12H,5,7-11,14H2 |
| InChIKey | YPJAILDWWQVCNX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 106.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|