C23H27N5O5 — CID 87958898
6-nitro-2,3-dihydro-1H-indole;1-(6-nitro-2,3-dihydroindol-1-yl)-2-piperidin-1-ylethanone (PubChem CID 87958898) has the molecular formula C23H27N5O5 and a molecular weight of 453.50 g/mol. Its IUPAC name is 6-nitro-2,3-dihydro-1H-indole;1-(6-nitro-2,3-dihydroindol-1-yl)-2-piperidin-1-ylethanone.
| Compound Name | 6-nitro-2,3-dihydro-1H-indole;1-(6-nitro-2,3-dihydroindol-1-yl)-2-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 87958898 |
| Molecular Formula | C23H27N5O5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 6-nitro-2,3-dihydro-1H-indole;1-(6-nitro-2,3-dihydroindol-1-yl)-2-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCCCC1)N1CCc2ccc([N+](=O)[O-])cc21.O=[N+]([O-])c1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C15H19N3O3.C8H8N2O2/c19-15(11-16-7-2-1-3-8-16)17-9-6-12-4-5-13(18(20)21)10-14(12)17;11-10(12)7-2-1-6-3-4-9-8(6)5-7/h4-5,10H,1-3,6-9,11H2;1-2,5,9H,3-4H2 |
| InChIKey | ZZIGVORJZPBPLO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|