C20H22ClN5O3 — CID 133309405
2-[4-(3-chloro-5-nitro-2-pyridinyl)piperazin-1-yl]-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 133309405) has the molecular formula C20H22ClN5O3 and a molecular weight of 415.88 g/mol. Its IUPAC name is 2-[4-(3-chloro-5-nitro-2-pyridinyl)piperazin-1-yl]-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone.
| Compound Name | 2-[4-(3-chloro-5-nitro-2-pyridinyl)piperazin-1-yl]-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 133309405 |
| Molecular Formula | C20H22ClN5O3 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-[4-(3-chloro-5-nitro-2-pyridinyl)piperazin-1-yl]-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | O=C(CN1CCN(c2ncc([N+](=O)[O-])cc2Cl)CC1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H22ClN5O3/c21-17-12-16(26(28)29)13-22-20(17)24-10-8-23(9-11-24)14-19(27)25-7-3-5-15-4-1-2-6-18(15)25/h1-2,4,6,12-13H,3,5,7-11,14H2 |
| InChIKey | NCQSPGZMPSHKNK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|