C22H26N4O4 — CID 2990925
3,4-dihydro-2H-quinolin-1-yl-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitrophenyl]methanone (PubChem CID 2990925) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-yl-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitrophenyl]methanone.
| Compound Name | 3,4-dihydro-2H-quinolin-1-yl-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitrophenyl]methanone |
|---|---|
| PubChem CID | 2990925 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-yl-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-nitrophenyl]methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1N1CCN(CCO)CC1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C22H26N4O4/c27-15-14-23-10-12-24(13-11-23)21-8-7-18(26(29)30)16-19(21)22(28)25-9-3-5-17-4-1-2-6-20(17)25/h1-2,4,6-8,16,27H,3,5,9-15H2 |
| InChIKey | KWUMKTBLYJTVCO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|