C22H27N4O4+ — CID 7390314
3,4-dihydro-2H-quinolin-1-yl-[4-[4-(2-hydroxyethyl)piperazin-4-ium-1-yl]-3-nitrophenyl]methanone (PubChem CID 7390314) has the molecular formula C22H27N4O4+ and a molecular weight of 411.48 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-yl-[4-[4-(2-hydroxyethyl)piperazin-4-ium-1-yl]-3-nitrophenyl]methanone.
| Compound Name | 3,4-dihydro-2H-quinolin-1-yl-[4-[4-(2-hydroxyethyl)piperazin-4-ium-1-yl]-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 7390314 |
| Molecular Formula | C22H27N4O4+ |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-yl-[4-[4-(2-hydroxyethyl)piperazin-4-ium-1-yl]-3-nitrophenyl]methanone |
| SMILES | O=C(c1ccc(N2CC[NH+](CCO)CC2)c([N+](=O)[O-])c1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C22H26N4O4/c27-15-14-23-10-12-24(13-11-23)20-8-7-18(16-21(20)26(29)30)22(28)25-9-3-5-17-4-1-2-6-19(17)25/h1-2,4,6-8,16,27H,3,5,9-15H2/p+1 |
| InChIKey | UFQTUFAPZHGCTB-UHFFFAOYSA-O |
| XLogP | 0.88 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|