C21H23N3O3 — CID 112765925
(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone (PubChem CID 112765925) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (2-methyl-3,4-dihydro-2H-quinolin-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone.
| Compound Name | (2-methyl-3,4-dihydro-2H-quinolin-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 112765925 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (2-methyl-3,4-dihydro-2H-quinolin-1-yl)-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone |
| SMILES | CC1CCc2ccccc2N1C(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N3O3/c1-15-8-9-16-6-2-3-7-18(16)23(15)21(25)17-10-11-19(20(14-17)24(26)27)22-12-4-5-13-22/h2-3,6-7,10-11,14-15H,4-5,8-9,12-13H2,1H3 |
| InChIKey | UZTWVPYPMZTOBB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|