C22H25N3O3 — CID 7891549
3-nitro-4-piperidin-1-yl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide (PubChem CID 7891549) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-nitro-4-piperidin-1-yl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide.
| Compound Name | 3-nitro-4-piperidin-1-yl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 7891549 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-nitro-4-piperidin-1-yl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
| SMILES | O=C(N[C@H]1CCCc2ccccc21)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H25N3O3/c26-22(23-19-10-6-8-16-7-2-3-9-18(16)19)17-11-12-20(21(15-17)25(27)28)24-13-4-1-5-14-24/h2-3,7,9,11-12,15,19H,1,4-6,8,10,13-14H2,(H,23,26)/t19-/m0/s1 |
| InChIKey | HEAQUYSOPXPQQR-IBGZPJMESA-N |
| XLogP | 4.39 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|