C20H18N4O3 — CID 5000431
4-imidazol-1-yl-3-nitro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide (PubChem CID 5000431) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-imidazol-1-yl-3-nitro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide.
| Compound Name | 4-imidazol-1-yl-3-nitro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 5000431 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 4-imidazol-1-yl-3-nitro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
| SMILES | O=C(NC1CCCc2ccccc21)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18N4O3/c25-20(22-17-7-3-5-14-4-1-2-6-16(14)17)15-8-9-18(19(12-15)24(26)27)23-11-10-21-13-23/h1-2,4,6,8-13,17H,3,5,7H2,(H,22,25) |
| InChIKey | UFXSJJPFLXUQGK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|