C15H16N4O5S — CID 60512004
N-(1,1-dioxothian-4-yl)-4-imidazol-1-yl-3-nitrobenzamide (PubChem CID 60512004) has the molecular formula C15H16N4O5S and a molecular weight of 364.38 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-4-imidazol-1-yl-3-nitrobenzamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-4-imidazol-1-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 60512004 |
| Molecular Formula | C15H16N4O5S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-4-imidazol-1-yl-3-nitrobenzamide |
| SMILES | O=C(NC1CCS(=O)(=O)CC1)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H16N4O5S/c20-15(17-12-3-7-25(23,24)8-4-12)11-1-2-13(14(9-11)19(21)22)18-6-5-16-10-18/h1-2,5-6,9-10,12H,3-4,7-8H2,(H,17,20) |
| InChIKey | LGWDOIUAGCVPFE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|