C15H19Cl2N5O4 — CID 120947350
N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-imidazol-1-yl-3-nitrobenzamide;dihydrochloride (PubChem CID 120947350) has the molecular formula C15H19Cl2N5O4 and a molecular weight of 404.25 g/mol. Its IUPAC name is N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-imidazol-1-yl-3-nitrobenzamide;dihydrochloride.
| Compound Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-imidazol-1-yl-3-nitrobenzamide;dihydrochloride |
|---|---|
| PubChem CID | 120947350 |
| Molecular Formula | C15H19Cl2N5O4 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-imidazol-1-yl-3-nitrobenzamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCC1CNCC1O)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17N5O4.2ClH/c21-14-8-17-6-11(14)7-18-15(22)10-1-2-12(13(5-10)20(23)24)19-4-3-16-9-19;;/h1-5,9,11,14,17,21H,6-8H2,(H,18,22);2*1H |
| InChIKey | LECMNVOYVVHZMZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|