C22H20N4O3 — CID 2979752
3,4-dihydro-2H-quinolin-1-yl-[3-nitro-4-(pyridin-3-ylmethylamino)phenyl]methanone (PubChem CID 2979752) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-yl-[3-nitro-4-(pyridin-3-ylmethylamino)phenyl]methanone.
| Compound Name | 3,4-dihydro-2H-quinolin-1-yl-[3-nitro-4-(pyridin-3-ylmethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 2979752 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-yl-[3-nitro-4-(pyridin-3-ylmethylamino)phenyl]methanone |
| SMILES | O=C(c1ccc(NCc2cccnc2)c([N+](=O)[O-])c1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C22H20N4O3/c27-22(25-12-4-7-17-6-1-2-8-20(17)25)18-9-10-19(21(13-18)26(28)29)24-15-16-5-3-11-23-14-16/h1-3,5-6,8-11,13-14,24H,4,7,12,15H2 |
| InChIKey | ZHCRDOPTNMQCMA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|