C16H16N4O3 — CID 110306395
[2-(dimethylamino)-3-pyridinyl]-(6-nitro-2,3-dihydroindol-1-yl)methanone (PubChem CID 110306395) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is [2-(dimethylamino)-3-pyridinyl]-(6-nitro-2,3-dihydroindol-1-yl)methanone.
| Compound Name | [2-(dimethylamino)-3-pyridinyl]-(6-nitro-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 110306395 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [2-(dimethylamino)-3-pyridinyl]-(6-nitro-2,3-dihydroindol-1-yl)methanone |
| SMILES | CN(C)c1ncccc1C(=O)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H16N4O3/c1-18(2)15-13(4-3-8-17-15)16(21)19-9-7-11-5-6-12(20(22)23)10-14(11)19/h3-6,8,10H,7,9H2,1-2H3 |
| InChIKey | BJIHBACTANSSAC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|