C18H13N3O4 — CID 71900043
4-(6-nitro-2,3-dihydroindole-1-carbonyl)-1H-quinolin-2-one (PubChem CID 71900043) has the molecular formula C18H13N3O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is 4-(6-nitro-2,3-dihydroindole-1-carbonyl)-1H-quinolin-2-one.
| Compound Name | 4-(6-nitro-2,3-dihydroindole-1-carbonyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 71900043 |
| Molecular Formula | C18H13N3O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 4-(6-nitro-2,3-dihydroindole-1-carbonyl)-1H-quinolin-2-one |
| SMILES | O=C(c1cc(=O)[nH]c2ccccc12)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H13N3O4/c22-17-10-14(13-3-1-2-4-15(13)19-17)18(23)20-8-7-11-5-6-12(21(24)25)9-16(11)20/h1-6,9-10H,7-8H2,(H,19,22) |
| InChIKey | QWHAMHATMDWPNF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|