C18H15N3O3 — CID 47016880
2-(1H-indol-3-yl)-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 47016880) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-(1H-indol-3-yl)-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 47016880 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-(1H-indol-3-yl)-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | O=C(Cc1c[nH]c2ccccc12)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H15N3O3/c22-18(9-13-11-19-16-4-2-1-3-15(13)16)20-8-7-12-5-6-14(21(23)24)10-17(12)20/h1-6,10-11,19H,7-9H2 |
| InChIKey | DPFNQGBZLZMNGY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|