C20H21N3O3S — CID 26769527
1-[2-(1H-indol-3-yl)acetyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 26769527) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)acetyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[2-(1H-indol-3-yl)acetyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 26769527 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)acetyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H21N3O3S/c1-22(2)27(25,26)16-7-8-19-14(11-16)9-10-23(19)20(24)12-15-13-21-18-6-4-3-5-17(15)18/h3-8,11,13,21H,9-10,12H2,1-2H3 |
| InChIKey | HIPTYKMVAMOBMR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |