C18H17FN2O3 — CID 110427340
4-(2-fluorophenyl)-1-(6-nitro-2,3-dihydroindol-1-yl)butan-1-one (PubChem CID 110427340) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-1-(6-nitro-2,3-dihydroindol-1-yl)butan-1-one.
| Compound Name | 4-(2-fluorophenyl)-1-(6-nitro-2,3-dihydroindol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 110427340 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-(2-fluorophenyl)-1-(6-nitro-2,3-dihydroindol-1-yl)butan-1-one |
| SMILES | O=C(CCCc1ccccc1F)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H17FN2O3/c19-16-6-2-1-4-13(16)5-3-7-18(22)20-11-10-14-8-9-15(21(23)24)12-17(14)20/h1-2,4,6,8-9,12H,3,5,7,10-11H2 |
| InChIKey | SEPISSQSYFXNNK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|