C18H24N2O5 — CID 171647830
methyl 9-(6-nitro-2,3-dihydroindol-1-yl)-9-oxononanoate (PubChem CID 171647830) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 9-(6-nitro-2,3-dihydroindol-1-yl)-9-oxononanoate.
| Compound Name | methyl 9-(6-nitro-2,3-dihydroindol-1-yl)-9-oxononanoate |
|---|---|
| PubChem CID | 171647830 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | methyl 9-(6-nitro-2,3-dihydroindol-1-yl)-9-oxononanoate |
| SMILES | COC(=O)CCCCCCCC(=O)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H24N2O5/c1-25-18(22)8-6-4-2-3-5-7-17(21)19-12-11-14-9-10-15(20(23)24)13-16(14)19/h9-10,13H,2-8,11-12H2,1H3 |
| InChIKey | CAMLVJZJZBLOED-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|