C14H18ClN3O5 — CID 119911081
3-[methyl-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]amino]propanoic acid;hydrochloride (PubChem CID 119911081) has the molecular formula C14H18ClN3O5 and a molecular weight of 343.77 g/mol. Its IUPAC name is 3-[methyl-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]amino]propanoic acid;hydrochloride.
| Compound Name | 3-[methyl-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119911081 |
| Molecular Formula | C14H18ClN3O5 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 3-[methyl-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]amino]propanoic acid;hydrochloride |
| SMILES | CN(CCC(=O)O)CC(=O)N1CCc2ccc([N+](=O)[O-])cc21.Cl |
| InChI | InChI=1S/C14H17N3O5.ClH/c1-15(6-5-14(19)20)9-13(18)16-7-4-10-2-3-11(17(21)22)8-12(10)16;/h2-3,8H,4-7,9H2,1H3,(H,19,20);1H |
| InChIKey | PNVWHXGPUISGFZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|