C15H20N4O4 — CID 38562265
2-[[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]-propan-2-ylamino]acetamide (PubChem CID 38562265) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-[[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]-propan-2-ylamino]acetamide.
| Compound Name | 2-[[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]-propan-2-ylamino]acetamide |
|---|---|
| PubChem CID | 38562265 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-[[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]-propan-2-ylamino]acetamide |
| SMILES | CC(C)N(CC(N)=O)CC(=O)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C15H20N4O4/c1-10(2)17(8-14(16)20)9-15(21)18-6-5-11-3-4-12(19(22)23)7-13(11)18/h3-4,7,10H,5-6,8-9H2,1-2H3,(H2,16,20) |
| InChIKey | HEKHIKHHQVYWFP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|