C21H19ClN4O3 — CID 60553328
[1-(3-chlorophenyl)-5-propan-2-ylpyrazol-4-yl]-(6-nitro-2,3-dihydroindol-1-yl)methanone (PubChem CID 60553328) has the molecular formula C21H19ClN4O3 and a molecular weight of 410.86 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-5-propan-2-ylpyrazol-4-yl]-(6-nitro-2,3-dihydroindol-1-yl)methanone.
| Compound Name | [1-(3-chlorophenyl)-5-propan-2-ylpyrazol-4-yl]-(6-nitro-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 60553328 |
| Molecular Formula | C21H19ClN4O3 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [1-(3-chlorophenyl)-5-propan-2-ylpyrazol-4-yl]-(6-nitro-2,3-dihydroindol-1-yl)methanone |
| SMILES | CC(C)c1c(C(=O)N2CCc3ccc([N+](=O)[O-])cc32)cnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H19ClN4O3/c1-13(2)20-18(12-23-25(20)16-5-3-4-15(22)10-16)21(27)24-9-8-14-6-7-17(26(28)29)11-19(14)24/h3-7,10-13H,8-9H2,1-2H3 |
| InChIKey | ABZYFCKOLPHNMM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|