C19H17ClN2O4 — CID 110630485
1-(2-chlorophenyl)-4-(7-nitro-3,4-dihydro-2H-quinolin-1-yl)butane-1,4-dione (PubChem CID 110630485) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4-(7-nitro-3,4-dihydro-2H-quinolin-1-yl)butane-1,4-dione.
| Compound Name | 1-(2-chlorophenyl)-4-(7-nitro-3,4-dihydro-2H-quinolin-1-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 110630485 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-(2-chlorophenyl)-4-(7-nitro-3,4-dihydro-2H-quinolin-1-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCCc2ccc([N+](=O)[O-])cc21)c1ccccc1Cl |
| InChI | InChI=1S/C19H17ClN2O4/c20-16-6-2-1-5-15(16)18(23)9-10-19(24)21-11-3-4-13-7-8-14(22(25)26)12-17(13)21/h1-2,5-8,12H,3-4,9-11H2 |
| InChIKey | ITMNAEGBEKJXTL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|