C13H18N2O3 — CID 143533155
ethane;1-(7-nitro-3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 143533155) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is ethane;1-(7-nitro-3,4-dihydro-2H-quinolin-1-yl)ethanone.
| Compound Name | ethane;1-(7-nitro-3,4-dihydro-2H-quinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 143533155 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | ethane;1-(7-nitro-3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | CC.CC(=O)N1CCCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C11H12N2O3.C2H6/c1-8(14)12-6-2-3-9-4-5-10(13(15)16)7-11(9)12;1-2/h4-5,7H,2-3,6H2,1H3;1-2H3 |
| InChIKey | QKCRHKPSSCRFFO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|