About N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide
N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide (PubChem CID 110291960) has the molecular formula C11H15N3O4S
and a molecular weight of 285.32 g/mol. Its IUPAC name is N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide.
Molecular Properties
| Compound Name | N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide |
| PubChem CID | 110291960 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C11H15N3O4S/c1-12(2)19(17,18)13-7-3-4-9-5-6-10(14(15)16)8-11(9)13/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | YDFNODMVEZWZEG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide?
The IUPAC name of N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide (CID 110291960) is N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide.
What is the SMILES notation for N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide?
The canonical SMILES for N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide is CN(C)S(=O)(=O)N1CCCc2ccc([N+](=O)[O-])cc21.
What is the InChIKey of N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide?
The InChIKey is YDFNODMVEZWZEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O4S/c1-12(2)19(17,18)13-7-3-4-9-5-6-10(14(15)16)8-11(9)13/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide?
N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide has a molecular weight of 285.32 g/mol, XLogP of 1.15, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide is sourced from PubChem (CID 110291960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).