C11H15N3O4S — CID 110291960
N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide (PubChem CID 110291960) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide.
| Compound Name | N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide |
|---|---|
| PubChem CID | 110291960 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N,N-dimethyl-7-nitro-3,4-dihydro-2H-quinoline-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C11H15N3O4S/c1-12(2)19(17,18)13-7-3-4-9-5-6-10(14(15)16)8-11(9)13/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | YDFNODMVEZWZEG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|