C15H20N2O4S — CID 122630596
1-cyclohexylsulfonyl-7-nitro-3,4-dihydro-2H-quinoline (PubChem CID 122630596) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 1-cyclohexylsulfonyl-7-nitro-3,4-dihydro-2H-quinoline.
| Compound Name | 1-cyclohexylsulfonyl-7-nitro-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 122630596 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-cyclohexylsulfonyl-7-nitro-3,4-dihydro-2H-quinoline |
| SMILES | O=[N+]([O-])c1ccc2c(c1)N(S(=O)(=O)C1CCCCC1)CCC2 |
| InChI | InChI=1S/C15H20N2O4S/c18-17(19)13-9-8-12-5-4-10-16(15(12)11-13)22(20,21)14-6-2-1-3-7-14/h8-9,11,14H,1-7,10H2 |
| InChIKey | VBLYPWHPXYLGIP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|