C12H16N2O3 — CID 69040269
1-(2-methoxyethyl)-7-nitro-3,4-dihydro-2H-quinoline (PubChem CID 69040269) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-7-nitro-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(2-methoxyethyl)-7-nitro-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 69040269 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-(2-methoxyethyl)-7-nitro-3,4-dihydro-2H-quinoline |
| SMILES | COCCN1CCCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C12H16N2O3/c1-17-8-7-13-6-2-3-10-4-5-11(14(15)16)9-12(10)13/h4-5,9H,2-3,6-8H2,1H3 |
| InChIKey | LVPJOMHDKJFWPO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|