C30H29Cl2N3O6 — CID 159411582
methyl (2S)-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-7-(7-nitro-3,4-dihydro-2H-quinolin-1-yl)-5-oxoheptanoate (PubChem CID 159411582) has the molecular formula C30H29Cl2N3O6 and a molecular weight of 598.48 g/mol. Its IUPAC name is methyl (2S)-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-7-(7-nitro-3,4-dihydro-2H-quinolin-1-yl)-5-oxoheptanoate.
| Compound Name | methyl (2S)-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-7-(7-nitro-3,4-dihydro-2H-quinolin-1-yl)-5-oxoheptanoate |
|---|---|
| PubChem CID | 159411582 |
| Molecular Formula | C30H29Cl2N3O6 |
| Molecular Weight | 598.48 g/mol |
| Exact Mass | 597.14 |
| IUPAC Name | methyl (2S)-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-7-(7-nitro-3,4-dihydro-2H-quinolin-1-yl)-5-oxoheptanoate |
| SMILES | COC(=O)[C@H](CCC(=O)CCN1CCCc2ccc([N+](=O)[O-])cc21)NC(=O)c1c(Cl)cc(-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C30H29Cl2N3O6/c1-41-30(38)26(33-29(37)28-24(31)16-21(17-25(28)32)19-6-3-2-4-7-19)12-11-23(36)13-15-34-14-5-8-20-9-10-22(35(39)40)18-27(20)34/h2-4,6-7,9-10,16-18,26H,5,8,11-15H2,1H3,(H,33,37)/t26-/m0/s1 |
| InChIKey | BFRSEKNDFDZQFL-SANMLTNESA-N |
| XLogP | 6.03 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|