C14H15ClN2O4 — CID 87841343
4-(8-nitro-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-3-oxobutanoyl chloride (PubChem CID 87841343) has the molecular formula C14H15ClN2O4 and a molecular weight of 310.74 g/mol. Its IUPAC name is 4-(8-nitro-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-3-oxobutanoyl chloride.
| Compound Name | 4-(8-nitro-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-3-oxobutanoyl chloride |
|---|---|
| PubChem CID | 87841343 |
| Molecular Formula | C14H15ClN2O4 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 4-(8-nitro-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-3-oxobutanoyl chloride |
| SMILES | O=C(Cl)CC(=O)CN1CCCCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C14H15ClN2O4/c15-14(19)8-12(18)9-16-6-2-1-3-10-4-5-11(17(20)21)7-13(10)16/h4-5,7H,1-3,6,8-9H2 |
| InChIKey | AJAJBSSKBCAOLL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|