C27H26Cl2N4O9 — CID 162193199
methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-(4-nitrophenyl)propanoate (PubChem CID 162193199) has the molecular formula C27H26Cl2N4O9 and a molecular weight of 621.43 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-(4-nitrophenyl)propanoate.
| Compound Name | methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 162193199 |
| Molecular Formula | C27H26Cl2N4O9 |
| Molecular Weight | 621.43 g/mol |
| Exact Mass | 620.11 |
| IUPAC Name | methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-(4-nitrophenyl)propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1ccc([N+](=O)[O-])cc1.COC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H14Cl2N2O5.C10H12N2O4/c1-26-17(23)14(9-10-5-7-11(8-6-10)21(24)25)20-16(22)15-12(18)3-2-4-13(15)19;1-16-10(13)9(11)6-7-2-4-8(5-3-7)12(14)15/h2-8,14H,9H2,1H3,(H,20,22);2-5,9H,6,11H2,1H3/t14-;9-/m00/s1 |
| InChIKey | ZQPAQYFBMHSVFH-FNADLCRPSA-N |
| XLogP | 4.05 |
| TPSA | 194.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|