C18H17ClN2O4S — CID 12044227
methyl (2S)-2-[(2-chloro-6-methylbenzenecarbothioyl)amino]-3-(4-nitrophenyl)propanoate (PubChem CID 12044227) has the molecular formula C18H17ClN2O4S and a molecular weight of 392.86 g/mol. Its IUPAC name is methyl (2S)-2-[(2-chloro-6-methylbenzenecarbothioyl)amino]-3-(4-nitrophenyl)propanoate.
| Compound Name | methyl (2S)-2-[(2-chloro-6-methylbenzenecarbothioyl)amino]-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 12044227 |
| Molecular Formula | C18H17ClN2O4S |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | methyl (2S)-2-[(2-chloro-6-methylbenzenecarbothioyl)amino]-3-(4-nitrophenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=S)c1c(C)cccc1Cl |
| InChI | InChI=1S/C18H17ClN2O4S/c1-11-4-3-5-14(19)16(11)17(26)20-15(18(22)25-2)10-12-6-8-13(9-7-12)21(23)24/h3-9,15H,10H2,1-2H3,(H,20,26)/t15-/m0/s1 |
| InChIKey | FTHZWBGNOBWACY-HNNXBMFYSA-N |
| XLogP | 3.61 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|