C19H26N2O5S — CID 12019596
methyl (2S)-2-[[1-(2-methoxyethyl)cyclopentanecarbothioyl]amino]-3-(4-nitrophenyl)propanoate (PubChem CID 12019596) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is methyl (2S)-2-[[1-(2-methoxyethyl)cyclopentanecarbothioyl]amino]-3-(4-nitrophenyl)propanoate.
| Compound Name | methyl (2S)-2-[[1-(2-methoxyethyl)cyclopentanecarbothioyl]amino]-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 12019596 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | methyl (2S)-2-[[1-(2-methoxyethyl)cyclopentanecarbothioyl]amino]-3-(4-nitrophenyl)propanoate |
| SMILES | COCCC1(C(=S)N[C@@H](Cc2ccc([N+](=O)[O-])cc2)C(=O)OC)CCCC1 |
| InChI | InChI=1S/C19H26N2O5S/c1-25-12-11-19(9-3-4-10-19)18(27)20-16(17(22)26-2)13-14-5-7-15(8-6-14)21(23)24/h5-8,16H,3-4,9-13H2,1-2H3,(H,20,27)/t16-/m0/s1 |
| InChIKey | GSKVOWPLWHIEES-INIZCTEOSA-N |
| XLogP | 3.19 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|