C26H30Cl2N2O3S — CID 22954332
2,6-dichloro-N-[4-[2-[[1-(2-methoxyethyl)cyclopentanecarbothioyl]amino]-3-oxobutyl]phenyl]benzamide (PubChem CID 22954332) has the molecular formula C26H30Cl2N2O3S and a molecular weight of 521.51 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-[2-[[1-(2-methoxyethyl)cyclopentanecarbothioyl]amino]-3-oxobutyl]phenyl]benzamide.
| Compound Name | 2,6-dichloro-N-[4-[2-[[1-(2-methoxyethyl)cyclopentanecarbothioyl]amino]-3-oxobutyl]phenyl]benzamide |
|---|---|
| PubChem CID | 22954332 |
| Molecular Formula | C26H30Cl2N2O3S |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 2,6-dichloro-N-[4-[2-[[1-(2-methoxyethyl)cyclopentanecarbothioyl]amino]-3-oxobutyl]phenyl]benzamide |
| SMILES | COCCC1(C(=S)NC(Cc2ccc(NC(=O)c3c(Cl)cccc3Cl)cc2)C(C)=O)CCCC1 |
| InChI | InChI=1S/C26H30Cl2N2O3S/c1-17(31)22(30-25(34)26(14-15-33-2)12-3-4-13-26)16-18-8-10-19(11-9-18)29-24(32)23-20(27)6-5-7-21(23)28/h5-11,22H,3-4,12-16H2,1-2H3,(H,29,32)(H,30,34) |
| InChIKey | VLCLYGFBCLOHLT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|